C8H3F8NO2 — CID 134679073
6-(difluoromethyl)-4-(trifluoromethoxy)-5-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 134679073) has the molecular formula C8H3F8NO2 and a molecular weight of 297.10 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-(trifluoromethoxy)-5-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 6-(difluoromethyl)-4-(trifluoromethoxy)-5-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 134679073 |
| Molecular Formula | C8H3F8NO2 |
| Molecular Weight | 297.10 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 6-(difluoromethyl)-4-(trifluoromethoxy)-5-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(OC(F)(F)F)c(C(F)(F)F)c(C(F)F)[nH]1 |
| InChI | InChI=1S/C8H3F8NO2/c9-6(10)5-4(7(11,12)13)2(1-3(18)17-5)19-8(14,15)16/h1,6H,(H,17,18) |
| InChIKey | RFOLIUVUCOLUER-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.10 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |