C7H3F5N2O4 — CID 118837677
6-(difluoromethyl)-5-nitro-4-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 118837677) has the molecular formula C7H3F5N2O4 and a molecular weight of 274.10 g/mol. Its IUPAC name is 6-(difluoromethyl)-5-nitro-4-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 6-(difluoromethyl)-5-nitro-4-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118837677 |
| Molecular Formula | C7H3F5N2O4 |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 6-(difluoromethyl)-5-nitro-4-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | O=c1cc(OC(F)(F)F)c([N+](=O)[O-])c(C(F)F)[nH]1 |
| InChI | InChI=1S/C7H3F5N2O4/c8-6(9)4-5(14(16)17)2(1-3(15)13-4)18-7(10,11)12/h1,6H,(H,13,15) |
| InChIKey | TZPMWYZFIHDCOY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|