C9H5F5N2O2 — CID 134660016
2-[3-(difluoromethyl)-6-oxo-4-(trifluoromethoxy)-1H-pyridin-2-yl]acetonitrile (PubChem CID 134660016) has the molecular formula C9H5F5N2O2 and a molecular weight of 268.14 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-6-oxo-4-(trifluoromethoxy)-1H-pyridin-2-yl]acetonitrile.
| Compound Name | 2-[3-(difluoromethyl)-6-oxo-4-(trifluoromethoxy)-1H-pyridin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 134660016 |
| Molecular Formula | C9H5F5N2O2 |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-[3-(difluoromethyl)-6-oxo-4-(trifluoromethoxy)-1H-pyridin-2-yl]acetonitrile |
| SMILES | N#CCc1[nH]c(=O)cc(OC(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C9H5F5N2O2/c10-8(11)7-4(1-2-15)16-6(17)3-5(7)18-9(12,13)14/h3,8H,1H2,(H,16,17) |
| InChIKey | QWOKVZMSPOEGQD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |