C10H6BrF5N2O — CID 134682362
2-[6-(bromomethyl)-5-(difluoromethyl)-4-(trifluoromethoxy)-2-pyridinyl]acetonitrile (PubChem CID 134682362) has the molecular formula C10H6BrF5N2O and a molecular weight of 345.07 g/mol. Its IUPAC name is 2-[6-(bromomethyl)-5-(difluoromethyl)-4-(trifluoromethoxy)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[6-(bromomethyl)-5-(difluoromethyl)-4-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134682362 |
| Molecular Formula | C10H6BrF5N2O |
| Molecular Weight | 345.07 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 2-[6-(bromomethyl)-5-(difluoromethyl)-4-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1cc(OC(F)(F)F)c(C(F)F)c(CBr)n1 |
| InChI | InChI=1S/C10H6BrF5N2O/c11-4-6-8(9(12)13)7(19-10(14,15)16)3-5(18-6)1-2-17/h3,9H,1,4H2 |
| InChIKey | RHPLRVPYBMVQNK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.07 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|