C10H7F5N2O2 — CID 118803481
2-[6-(difluoromethyl)-4-methoxy-5-(trifluoromethoxy)-2-pyridinyl]acetonitrile (PubChem CID 118803481) has the molecular formula C10H7F5N2O2 and a molecular weight of 282.17 g/mol. Its IUPAC name is 2-[6-(difluoromethyl)-4-methoxy-5-(trifluoromethoxy)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[6-(difluoromethyl)-4-methoxy-5-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118803481 |
| Molecular Formula | C10H7F5N2O2 |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 2-[6-(difluoromethyl)-4-methoxy-5-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
| SMILES | COc1cc(CC#N)nc(C(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C10H7F5N2O2/c1-18-6-4-5(2-3-16)17-7(9(11)12)8(6)19-10(13,14)15/h4,9H,2H2,1H3 |
| InChIKey | YSFWMHRQCHHQFN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |