C10H6F6N2O2 — CID 134682248
2-[4-methoxy-5-(trifluoromethoxy)-6-(trifluoromethyl)-2-pyridinyl]acetonitrile (PubChem CID 134682248) has the molecular formula C10H6F6N2O2 and a molecular weight of 300.16 g/mol. Its IUPAC name is 2-[4-methoxy-5-(trifluoromethoxy)-6-(trifluoromethyl)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[4-methoxy-5-(trifluoromethoxy)-6-(trifluoromethyl)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134682248 |
| Molecular Formula | C10H6F6N2O2 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2-[4-methoxy-5-(trifluoromethoxy)-6-(trifluoromethyl)-2-pyridinyl]acetonitrile |
| SMILES | COc1cc(CC#N)nc(C(F)(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C10H6F6N2O2/c1-19-6-4-5(2-3-17)18-8(9(11,12)13)7(6)20-10(14,15)16/h4H,2H2,1H3 |
| InChIKey | HXRVWWLGGBNRQK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |