C8H6BrF5N2O — CID 119009701
6-(bromomethyl)-3-(difluoromethyl)-4-(trifluoromethoxy)pyridin-2-amine (PubChem CID 119009701) has the molecular formula C8H6BrF5N2O and a molecular weight of 321.04 g/mol. Its IUPAC name is 6-(bromomethyl)-3-(difluoromethyl)-4-(trifluoromethoxy)pyridin-2-amine.
| Compound Name | 6-(bromomethyl)-3-(difluoromethyl)-4-(trifluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 119009701 |
| Molecular Formula | C8H6BrF5N2O |
| Molecular Weight | 321.04 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 6-(bromomethyl)-3-(difluoromethyl)-4-(trifluoromethoxy)pyridin-2-amine |
| SMILES | Nc1nc(CBr)cc(OC(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C8H6BrF5N2O/c9-2-3-1-4(17-8(12,13)14)5(6(10)11)7(15)16-3/h1,6H,2H2,(H2,15,16) |
| InChIKey | RSVTZRSAKINUKG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.04 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|