C7H2Cl2F3NO3 — CID 118852875
1,5-dichloro-2-nitro-3-(trifluoromethoxy)benzene (PubChem CID 118852875) has the molecular formula C7H2Cl2F3NO3 and a molecular weight of 276.00 g/mol. Its IUPAC name is 1,5-dichloro-2-nitro-3-(trifluoromethoxy)benzene.
| Compound Name | 1,5-dichloro-2-nitro-3-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 118852875 |
| Molecular Formula | C7H2Cl2F3NO3 |
| Molecular Weight | 276.00 g/mol |
| Exact Mass | 274.94 |
| IUPAC Name | 1,5-dichloro-2-nitro-3-(trifluoromethoxy)benzene |
| SMILES | O=[N+]([O-])c1c(Cl)cc(Cl)cc1OC(F)(F)F |
| InChI | InChI=1S/C7H2Cl2F3NO3/c8-3-1-4(9)6(13(14)15)5(2-3)16-7(10,11)12/h1-2H |
| InChIKey | WSHQUIJSQROCRC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.00 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|