C14H8Cl4N2O5 — CID 139785843
1,5-dichloro-3-[(3,5-dichloro-2-nitrophenyl)methoxymethyl]-2-nitrobenzene (PubChem CID 139785843) has the molecular formula C14H8Cl4N2O5 and a molecular weight of 426.04 g/mol. Its IUPAC name is 1,5-dichloro-3-[(3,5-dichloro-2-nitrophenyl)methoxymethyl]-2-nitrobenzene.
| Compound Name | 1,5-dichloro-3-[(3,5-dichloro-2-nitrophenyl)methoxymethyl]-2-nitrobenzene |
|---|---|
| PubChem CID | 139785843 |
| Molecular Formula | C14H8Cl4N2O5 |
| Molecular Weight | 426.04 g/mol |
| Exact Mass | 423.92 |
| IUPAC Name | 1,5-dichloro-3-[(3,5-dichloro-2-nitrophenyl)methoxymethyl]-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1c(Cl)cc(Cl)cc1COCc1cc(Cl)cc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8Cl4N2O5/c15-9-1-7(13(19(21)22)11(17)3-9)5-25-6-8-2-10(16)4-12(18)14(8)20(23)24/h1-4H,5-6H2 |
| InChIKey | AOBNXENUYZOOHS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.04 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|