C14H10F3N3O2 — CID 16768729
5-amino-6-[2-(trifluoromethoxy)phenyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 16768729) has the molecular formula C14H10F3N3O2 and a molecular weight of 309.25 g/mol. Its IUPAC name is 5-amino-6-[2-(trifluoromethoxy)phenyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-amino-6-[2-(trifluoromethoxy)phenyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 16768729 |
| Molecular Formula | C14H10F3N3O2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-amino-6-[2-(trifluoromethoxy)phenyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | Nc1cc2[nH]c(=O)[nH]c2cc1-c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H10F3N3O2/c15-14(16,17)22-12-4-2-1-3-7(12)8-5-10-11(6-9(8)18)20-13(21)19-10/h1-6H,18H2,(H2,19,20,21) |
| InChIKey | MXYOUPINSVXJQF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|