C13H8F5NO — CID 89422799
3,5-difluoro-4-[2-(trifluoromethoxy)phenyl]aniline (PubChem CID 89422799) has the molecular formula C13H8F5NO and a molecular weight of 289.20 g/mol. Its IUPAC name is 3,5-difluoro-4-[2-(trifluoromethoxy)phenyl]aniline.
| Compound Name | 3,5-difluoro-4-[2-(trifluoromethoxy)phenyl]aniline |
|---|---|
| PubChem CID | 89422799 |
| Molecular Formula | C13H8F5NO |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 3,5-difluoro-4-[2-(trifluoromethoxy)phenyl]aniline |
| SMILES | Nc1cc(F)c(-c2ccccc2OC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C13H8F5NO/c14-9-5-7(19)6-10(15)12(9)8-3-1-2-4-11(8)20-13(16,17)18/h1-6H,19H2 |
| InChIKey | HIUNNQRPIKIHEN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|