C42H58N6O12 — CID 118542242
tert-butyl [(1,4-dimethyl-5-oxo-3-phenylpyrazol-4-yl)-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate (PubChem CID 118542242) has the molecular formula C42H58N6O12 and a molecular weight of 838.96 g/mol. Its IUPAC name is tert-butyl [(1,4-dimethyl-5-oxo-3-phenylpyrazol-4-yl)-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate.
| Compound Name | tert-butyl [(1,4-dimethyl-5-oxo-3-phenylpyrazol-4-yl)-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
|---|---|
| PubChem CID | 118542242 |
| Molecular Formula | C42H58N6O12 |
| Molecular Weight | 838.96 g/mol |
| Exact Mass | 838.41 |
| IUPAC Name | tert-butyl [(1,4-dimethyl-5-oxo-3-phenylpyrazol-4-yl)-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
| SMILES | CN1N=C(c2ccccc2)C(C)(N(OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C1=O.CN1N=C(c2ccccc2)C(C)(N(OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/2C21H29N3O6/c2*1-19(2,3)28-17(26)24(30-18(27)29-20(4,5)6)21(7)15(22-23(8)16(21)25)14-12-10-9-11-13-14/h2*9-13H,1-8H3 |
| InChIKey | KEQCUOMETUFNMB-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 195.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.96 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|