C11H12N2OS — CID 118538602
2,4-dimethyl-5-phenyl-4-sulfanylpyrazol-3-one (PubChem CID 118538602) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 2,4-dimethyl-5-phenyl-4-sulfanylpyrazol-3-one.
| Compound Name | 2,4-dimethyl-5-phenyl-4-sulfanylpyrazol-3-one |
|---|---|
| PubChem CID | 118538602 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2,4-dimethyl-5-phenyl-4-sulfanylpyrazol-3-one |
| SMILES | CN1N=C(c2ccccc2)C(C)(S)C1=O |
| InChI | InChI=1S/C11H12N2OS/c1-11(15)9(12-13(2)10(11)14)8-6-4-3-5-7-8/h3-7,15H,1-2H3 |
| InChIKey | PLRVIDDDDZOKJK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 32.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|