C22H26N6O4 — CID 118541979
4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one (PubChem CID 118541979) has the molecular formula C22H26N6O4 and a molecular weight of 438.49 g/mol. Its IUPAC name is 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one.
| Compound Name | 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 118541979 |
| Molecular Formula | C22H26N6O4 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one |
| SMILES | CN1N=C(c2ccccc2)C(C)(NO)C1=O.CN1N=C(c2ccccc2)C(C)(NO)C1=O |
| InChI | InChI=1S/2C11H13N3O2/c2*1-11(13-16)9(12-14(2)10(11)15)8-6-4-3-5-7-8/h2*3-7,13,16H,1-2H3 |
| InChIKey | HMFFZWGSMDPQRH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|