About 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one
4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one (PubChem CID 118541979) has the molecular formula C22H26N6O4
and a molecular weight of 438.49 g/mol. Its IUPAC name is 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one.
Molecular Properties
| Compound Name | 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one |
| PubChem CID | 118541979 |
| Molecular Formula | C22H26N6O4 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one |
| SMILES | CN1N=C(c2ccccc2)C(C)(NO)C1=O.CN1N=C(c2ccccc2)C(C)(NO)C1=O |
| InChI | InChI=1S/2C11H13N3O2/c2*1-11(13-16)9(12-14(2)10(11)15)8-6-4-3-5-7-8/h2*3-7,13,16H,1-2H3 |
| InChIKey | HMFFZWGSMDPQRH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one?
The IUPAC name of 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one (CID 118541979) is 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one.
What is the SMILES notation for 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one?
The canonical SMILES for 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one is CN1N=C(c2ccccc2)C(C)(NO)C1=O.CN1N=C(c2ccccc2)C(C)(NO)C1=O.
What is the InChIKey of 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one?
The InChIKey is HMFFZWGSMDPQRH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H13N3O2/c2*1-11(13-16)9(12-14(2)10(11)15)8-6-4-3-5-7-8/h2*3-7,13,16H,1-2H3.
What are the key properties of 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one?
4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one has a molecular weight of 438.49 g/mol, XLogP of 1.20, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxyamino)-2,4-dimethyl-5-phenylpyrazol-3-one is sourced from PubChem (CID 118541979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).