C19H28N4O6S — CID 118538468
tert-butyl N-[3-[3-(dimethylamino)-4-methylsulfonylphenyl]-1,4-dimethyl-5-oxopyrazol-4-yl]-N-hydroxycarbamate (PubChem CID 118538468) has the molecular formula C19H28N4O6S and a molecular weight of 440.52 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(dimethylamino)-4-methylsulfonylphenyl]-1,4-dimethyl-5-oxopyrazol-4-yl]-N-hydroxycarbamate.
| Compound Name | tert-butyl N-[3-[3-(dimethylamino)-4-methylsulfonylphenyl]-1,4-dimethyl-5-oxopyrazol-4-yl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 118538468 |
| Molecular Formula | C19H28N4O6S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | tert-butyl N-[3-[3-(dimethylamino)-4-methylsulfonylphenyl]-1,4-dimethyl-5-oxopyrazol-4-yl]-N-hydroxycarbamate |
| SMILES | CN1N=C(c2ccc(S(C)(=O)=O)c(N(C)C)c2)C(C)(N(O)C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C19H28N4O6S/c1-18(2,3)29-17(25)23(26)19(4)15(20-22(7)16(19)24)12-9-10-14(30(8,27)28)13(11-12)21(5)6/h9-11,26H,1-8H3 |
| InChIKey | BDEPEEKZCIQRBV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|