C13H22N4O5 — CID 177439808
tert-butyl N-hydroxy-N-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-1,3-dimethyl-5-oxopyrazol-4-yl]carbamate (PubChem CID 177439808) has the molecular formula C13H22N4O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is tert-butyl N-hydroxy-N-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-1,3-dimethyl-5-oxopyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-hydroxy-N-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-1,3-dimethyl-5-oxopyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 177439808 |
| Molecular Formula | C13H22N4O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | tert-butyl N-hydroxy-N-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-1,3-dimethyl-5-oxopyrazol-4-yl]carbamate |
| SMILES | CO/N=C(\C)C1(N(O)C(=O)OC(C)(C)C)C(=O)N(C)N=C1C |
| InChI | InChI=1S/C13H22N4O5/c1-8-13(9(2)15-21-7,10(18)16(6)14-8)17(20)11(19)22-12(3,4)5/h20H,1-7H3/b15-9+ |
| InChIKey | HEGKLKOPVOMEDJ-OQLLNIDSSA-N |
| XLogP | 1.22 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|