C12H18ClN3O3 — CID 164902732
tert-butyl N-[(5-chloro-1-methyl-6-oxopyridazin-4-yl)methyl]-N-methylcarbamate (PubChem CID 164902732) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is tert-butyl N-[(5-chloro-1-methyl-6-oxopyridazin-4-yl)methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(5-chloro-1-methyl-6-oxopyridazin-4-yl)methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 164902732 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | tert-butyl N-[(5-chloro-1-methyl-6-oxopyridazin-4-yl)methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cnn(C)c(=O)c1Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H18ClN3O3/c1-12(2,3)19-11(18)15(4)7-8-6-14-16(5)10(17)9(8)13/h6H,7H2,1-5H3 |
| InChIKey | YGHVHUYDDNGDLC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |