C18H22ClN3O3 — CID 133452930
tert-butyl 2-[(5-chloro-1-methyl-6-oxopyridazin-4-yl)amino]-3-phenylpropanoate (PubChem CID 133452930) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is tert-butyl 2-[(5-chloro-1-methyl-6-oxopyridazin-4-yl)amino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[(5-chloro-1-methyl-6-oxopyridazin-4-yl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 133452930 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | tert-butyl 2-[(5-chloro-1-methyl-6-oxopyridazin-4-yl)amino]-3-phenylpropanoate |
| SMILES | Cn1ncc(NC(Cc2ccccc2)C(=O)OC(C)(C)C)c(Cl)c1=O |
| InChI | InChI=1S/C18H22ClN3O3/c1-18(2,3)25-17(24)13(10-12-8-6-5-7-9-12)21-14-11-20-22(4)16(23)15(14)19/h5-9,11,13,21H,10H2,1-4H3 |
| InChIKey | HEGRWPLIMOJLHO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |