C18H20N4O2 — CID 133452955
tert-butyl (2R)-2-[(6-cyanopyridazin-3-yl)amino]-3-phenylpropanoate (PubChem CID 133452955) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(6-cyanopyridazin-3-yl)amino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2R)-2-[(6-cyanopyridazin-3-yl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 133452955 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | tert-butyl (2R)-2-[(6-cyanopyridazin-3-yl)amino]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](Cc1ccccc1)Nc1ccc(C#N)nn1 |
| InChI | InChI=1S/C18H20N4O2/c1-18(2,3)24-17(23)15(11-13-7-5-4-6-8-13)20-16-10-9-14(12-19)21-22-16/h4-10,15H,11H2,1-3H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | IMBOCDDSPNOXCT-OAHLLOKOSA-N |
| XLogP | 2.71 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |