C14H22N4O4S — CID 176898171
tert-butyl (2S)-2-[(diaminomethylideneamino)sulfonylamino]-3-phenylpropanoate (PubChem CID 176898171) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(diaminomethylideneamino)sulfonylamino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[(diaminomethylideneamino)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 176898171 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | tert-butyl (2S)-2-[(diaminomethylideneamino)sulfonylamino]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccccc1)NS(=O)(=O)N=C(N)N |
| InChI | InChI=1S/C14H22N4O4S/c1-14(2,3)22-12(19)11(9-10-7-5-4-6-8-10)17-23(20,21)18-13(15)16/h4-8,11,17H,9H2,1-3H3,(H4,15,16,18)/t11-/m0/s1 |
| InChIKey | XYTDULVSKKEOIM-NSHDSACASA-N |
| XLogP | 0.05 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|