C17H21BrN2O3 — CID 178046458
tert-butyl N-[(6-bromo-2-methyl-1-oxoisoquinolin-4-yl)methyl]-N-methylcarbamate (PubChem CID 178046458) has the molecular formula C17H21BrN2O3 and a molecular weight of 381.27 g/mol. Its IUPAC name is tert-butyl N-[(6-bromo-2-methyl-1-oxoisoquinolin-4-yl)methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(6-bromo-2-methyl-1-oxoisoquinolin-4-yl)methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 178046458 |
| Molecular Formula | C17H21BrN2O3 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | tert-butyl N-[(6-bromo-2-methyl-1-oxoisoquinolin-4-yl)methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cn(C)c(=O)c2ccc(Br)cc12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H21BrN2O3/c1-17(2,3)23-16(22)20(5)10-11-9-19(4)15(21)13-7-6-12(18)8-14(11)13/h6-9H,10H2,1-5H3 |
| InChIKey | CYYFERMJTWLGEC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |