C26H34N6O4 — CID 118541987
4-(hydroxyamino)-5-methyl-4-phenyl-2-propan-2-ylpyrazol-3-one (PubChem CID 118541987) has the molecular formula C26H34N6O4 and a molecular weight of 494.60 g/mol. Its IUPAC name is 4-(hydroxyamino)-5-methyl-4-phenyl-2-propan-2-ylpyrazol-3-one.
| Compound Name | 4-(hydroxyamino)-5-methyl-4-phenyl-2-propan-2-ylpyrazol-3-one |
|---|---|
| PubChem CID | 118541987 |
| Molecular Formula | C26H34N6O4 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 4-(hydroxyamino)-5-methyl-4-phenyl-2-propan-2-ylpyrazol-3-one |
| SMILES | CC1=NN(C(C)C)C(=O)C1(NO)c1ccccc1.CC1=NN(C(C)C)C(=O)C1(NO)c1ccccc1 |
| InChI | InChI=1S/2C13H17N3O2/c2*1-9(2)16-12(17)13(15-18,10(3)14-16)11-7-5-4-6-8-11/h2*4-9,15,18H,1-3H3 |
| InChIKey | OWPNBKCDGUNBDO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|