C13H21NSi — CID 162413159
[(2R,3S)-1,3-dimethyl-2-phenylaziridin-2-yl]-trimethylsilane (PubChem CID 162413159) has the molecular formula C13H21NSi and a molecular weight of 219.40 g/mol. Its IUPAC name is [(2R,3S)-1,3-dimethyl-2-phenylaziridin-2-yl]-trimethylsilane.
| Compound Name | [(2R,3S)-1,3-dimethyl-2-phenylaziridin-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 162413159 |
| Molecular Formula | C13H21NSi |
| Molecular Weight | 219.40 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | [(2R,3S)-1,3-dimethyl-2-phenylaziridin-2-yl]-trimethylsilane |
| SMILES | C[C@@H]1N(C)[C@]1(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C13H21NSi/c1-11-13(14(11)2,15(3,4)5)12-9-7-6-8-10-12/h6-11H,1-5H3/t11-,13-,14?/m0/s1 |
| InChIKey | HKIJUBLUZVKSQE-ULVQEXTCSA-N |
| XLogP | 3.09 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|