C26H30ClNSi — CID 101359961
tert-butyl-[(2S,3R)-3-(4-chlorophenyl)-1,2-diphenylaziridin-2-yl]-dimethylsilane (PubChem CID 101359961) has the molecular formula C26H30ClNSi and a molecular weight of 420.07 g/mol. Its IUPAC name is tert-butyl-[(2S,3R)-3-(4-chlorophenyl)-1,2-diphenylaziridin-2-yl]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R)-3-(4-chlorophenyl)-1,2-diphenylaziridin-2-yl]-dimethylsilane |
|---|---|
| PubChem CID | 101359961 |
| Molecular Formula | C26H30ClNSi |
| Molecular Weight | 420.07 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | tert-butyl-[(2S,3R)-3-(4-chlorophenyl)-1,2-diphenylaziridin-2-yl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)[C@@]1(c2ccccc2)[C@@H](c2ccc(Cl)cc2)N1c1ccccc1 |
| InChI | InChI=1S/C26H30ClNSi/c1-25(2,3)29(4,5)26(21-12-8-6-9-13-21)24(20-16-18-22(27)19-17-20)28(26)23-14-10-7-11-15-23/h6-19,24H,1-5H3/t24-,26+,28?/m1/s1 |
| InChIKey | MIYOTIDYVFMUPO-MAKPOSLASA-N |
| XLogP | 7.84 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.07 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|