C21H18FNO — CID 11544255
(2S,3R)-2-fluoro-3-(4-methoxyphenyl)-1,2-diphenylaziridine (PubChem CID 11544255) has the molecular formula C21H18FNO and a molecular weight of 319.38 g/mol. Its IUPAC name is (2S,3R)-2-fluoro-3-(4-methoxyphenyl)-1,2-diphenylaziridine.
| Compound Name | (2S,3R)-2-fluoro-3-(4-methoxyphenyl)-1,2-diphenylaziridine |
|---|---|
| PubChem CID | 11544255 |
| Molecular Formula | C21H18FNO |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (2S,3R)-2-fluoro-3-(4-methoxyphenyl)-1,2-diphenylaziridine |
| SMILES | COc1ccc([C@H]2N(c3ccccc3)[C@]2(F)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18FNO/c1-24-19-14-12-16(13-15-19)20-21(22,17-8-4-2-5-9-17)23(20)18-10-6-3-7-11-18/h2-15,20H,1H3/t20-,21-,23?/m1/s1 |
| InChIKey | QLDQJPGQQQWWEQ-OJOWTSHBSA-N |
| XLogP | 5.08 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|