C12H17NO — CID 162398178
3-(4-methoxyphenyl)-1,2,2-trimethylaziridine (PubChem CID 162398178) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1,2,2-trimethylaziridine.
| Compound Name | 3-(4-methoxyphenyl)-1,2,2-trimethylaziridine |
|---|---|
| PubChem CID | 162398178 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3-(4-methoxyphenyl)-1,2,2-trimethylaziridine |
| SMILES | COc1ccc(C2N(C)C2(C)C)cc1 |
| InChI | InChI=1S/C12H17NO/c1-12(2)11(13(12)3)9-5-7-10(14-4)8-6-9/h5-8,11H,1-4H3 |
| InChIKey | LQTUHOJWUCWUNU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|