C22H25NO4 — CID 139076255
(2R,6R)-2,6-bis(4-methoxyphenyl)-3,3-dimethyl-4-oxopiperidine-1-carbaldehyde (PubChem CID 139076255) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is (2R,6R)-2,6-bis(4-methoxyphenyl)-3,3-dimethyl-4-oxopiperidine-1-carbaldehyde.
| Compound Name | (2R,6R)-2,6-bis(4-methoxyphenyl)-3,3-dimethyl-4-oxopiperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 139076255 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (2R,6R)-2,6-bis(4-methoxyphenyl)-3,3-dimethyl-4-oxopiperidine-1-carbaldehyde |
| SMILES | COc1ccc([C@H]2CC(=O)C(C)(C)[C@@H](c3ccc(OC)cc3)N2C=O)cc1 |
| InChI | InChI=1S/C22H25NO4/c1-22(2)20(25)13-19(15-5-9-17(26-3)10-6-15)23(14-24)21(22)16-7-11-18(27-4)12-8-16/h5-12,14,19,21H,13H2,1-4H3/t19-,21-/m1/s1 |
| InChIKey | DDEWELJUUNRTKZ-TZIWHRDSSA-N |
| XLogP | 3.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|