C24H38N2OSi2 — CID 134984305
[(4S,9R)-9-(4-methoxyphenyl)-5,5,6-trimethyl-2-trimethylsilyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-dien-3-yl]-trimethylsilane (PubChem CID 134984305) has the molecular formula C24H38N2OSi2 and a molecular weight of 426.75 g/mol. Its IUPAC name is [(4S,9R)-9-(4-methoxyphenyl)-5,5,6-trimethyl-2-trimethylsilyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-dien-3-yl]-trimethylsilane.
| Compound Name | [(4S,9R)-9-(4-methoxyphenyl)-5,5,6-trimethyl-2-trimethylsilyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-dien-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 134984305 |
| Molecular Formula | C24H38N2OSi2 |
| Molecular Weight | 426.75 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | [(4S,9R)-9-(4-methoxyphenyl)-5,5,6-trimethyl-2-trimethylsilyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-dien-3-yl]-trimethylsilane |
| SMILES | COc1ccc([C@H]2CC3=C(C)C(C)(C)[C@H]4C([Si](C)(C)C)=C([Si](C)(C)C)N2N34)cc1 |
| InChI | InChI=1S/C24H38N2OSi2/c1-16-19-15-20(17-11-13-18(27-4)14-12-17)26-23(29(8,9)10)21(28(5,6)7)22(25(19)26)24(16,2)3/h11-14,20,22H,15H2,1-10H3/t20-,22-/m1/s1 |
| InChIKey | MPSLVMYSQBRRHI-IFMALSPDSA-N |
| XLogP | 6.36 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.75 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|