C16H18N2O2 — CID 141109770
3-(4-methoxyphenyl)-2-methyl-5-pyridin-4-yl-1,2-oxazolidine (PubChem CID 141109770) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-methyl-5-pyridin-4-yl-1,2-oxazolidine.
| Compound Name | 3-(4-methoxyphenyl)-2-methyl-5-pyridin-4-yl-1,2-oxazolidine |
|---|---|
| PubChem CID | 141109770 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-methyl-5-pyridin-4-yl-1,2-oxazolidine |
| SMILES | COc1ccc(C2CC(c3ccncc3)ON2C)cc1 |
| InChI | InChI=1S/C16H18N2O2/c1-18-15(12-3-5-14(19-2)6-4-12)11-16(20-18)13-7-9-17-10-8-13/h3-10,15-16H,11H2,1-2H3 |
| InChIKey | KDVRGOZNJGJJAQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |