C17H20N2O — CID 127245045
4-[[2-(4-methoxyphenyl)pyrrolidin-1-yl]methyl]pyridine (PubChem CID 127245045) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-[[2-(4-methoxyphenyl)pyrrolidin-1-yl]methyl]pyridine.
| Compound Name | 4-[[2-(4-methoxyphenyl)pyrrolidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 127245045 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 4-[[2-(4-methoxyphenyl)pyrrolidin-1-yl]methyl]pyridine |
| SMILES | COc1ccc(C2CCCN2Cc2ccncc2)cc1 |
| InChI | InChI=1S/C17H20N2O/c1-20-16-6-4-15(5-7-16)17-3-2-12-19(17)13-14-8-10-18-11-9-14/h4-11,17H,2-3,12-13H2,1H3 |
| InChIKey | SCWQZZYVNQIZBK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |