C19H22N2O4 — CID 101045950
N-[(2R,6S)-1-hydroxy-2,6-bis(4-methoxyphenyl)piperidin-4-ylidene]hydroxylamine (PubChem CID 101045950) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[(2R,6S)-1-hydroxy-2,6-bis(4-methoxyphenyl)piperidin-4-ylidene]hydroxylamine.
| Compound Name | N-[(2R,6S)-1-hydroxy-2,6-bis(4-methoxyphenyl)piperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 101045950 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[(2R,6S)-1-hydroxy-2,6-bis(4-methoxyphenyl)piperidin-4-ylidene]hydroxylamine |
| SMILES | COc1ccc([C@H]2C/C(=N/O)C[C@@H](c3ccc(OC)cc3)N2O)cc1 |
| InChI | InChI=1S/C19H22N2O4/c1-24-16-7-3-13(4-8-16)18-11-15(20-22)12-19(21(18)23)14-5-9-17(25-2)10-6-14/h3-10,18-19,22-23H,11-12H2,1-2H3/b20-15-/t18-,19+/m1/s1 |
| InChIKey | IKDCDJVTQFUWEC-XKUXXELXSA-N |
| XLogP | 3.80 |
| TPSA | 74.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|