C15H21NO2 — CID 102517136
(2R,4aS,7aR)-1-hydroxy-2-(4-methoxyphenyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine (PubChem CID 102517136) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (2R,4aS,7aR)-1-hydroxy-2-(4-methoxyphenyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine.
| Compound Name | (2R,4aS,7aR)-1-hydroxy-2-(4-methoxyphenyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine |
|---|---|
| PubChem CID | 102517136 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (2R,4aS,7aR)-1-hydroxy-2-(4-methoxyphenyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine |
| SMILES | COc1ccc([C@H]2CC[C@@H]3CCC[C@H]3N2O)cc1 |
| InChI | InChI=1S/C15H21NO2/c1-18-13-8-5-12(6-9-13)15-10-7-11-3-2-4-14(11)16(15)17/h5-6,8-9,11,14-15,17H,2-4,7,10H2,1H3/t11-,14+,15+/m0/s1 |
| InChIKey | WGJIBZZLUSKDKN-NILFDRSVSA-N |
| XLogP | 3.39 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |