C21H30N2O3S — CID 165425451
(1R,2S,6R,9R)-11-cyclopropylsulfonyl-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane (PubChem CID 165425451) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is (1R,2S,6R,9R)-11-cyclopropylsulfonyl-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane.
| Compound Name | (1R,2S,6R,9R)-11-cyclopropylsulfonyl-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane |
|---|---|
| PubChem CID | 165425451 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (1R,2S,6R,9R)-11-cyclopropylsulfonyl-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane |
| SMILES | COc1ccc([C@H]2CCC[C@H]3[C@@H]4C[C@H](CN23)CN(S(=O)(=O)C2CC2)C4)cc1 |
| InChI | InChI=1S/C21H30N2O3S/c1-26-18-7-5-16(6-8-18)20-3-2-4-21-17-11-15(13-23(20)21)12-22(14-17)27(24,25)19-9-10-19/h5-8,15,17,19-21H,2-4,9-14H2,1H3/t15-,17+,20+,21-/m0/s1 |
| InChIKey | TUAYTVAGACALFZ-IAECCPNBSA-N |
| XLogP | 3.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |