C23H35Cl2N3O2 — CID 171322649
2-(cyclopropylamino)-1-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone;dihydrochloride (PubChem CID 171322649) has the molecular formula C23H35Cl2N3O2 and a molecular weight of 456.46 g/mol. Its IUPAC name is 2-(cyclopropylamino)-1-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone;dihydrochloride.
| Compound Name | 2-(cyclopropylamino)-1-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 171322649 |
| Molecular Formula | C23H35Cl2N3O2 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-(cyclopropylamino)-1-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone;dihydrochloride |
| SMILES | COc1ccc([C@H]2CCC[C@H]3[C@@H]4C[C@@H](CN(C(=O)CNC5CC5)C4)CN23)cc1.Cl.Cl |
| InChI | InChI=1S/C23H33N3O2.2ClH/c1-28-20-9-5-17(6-10-20)21-3-2-4-22-18-11-16(14-26(21)22)13-25(15-18)23(27)12-24-19-7-8-19;;/h5-6,9-10,16,18-19,21-22,24H,2-4,7-8,11-15H2,1H3;2*1H/t16-,18+,21+,22-;;/m0../s1 |
| InChIKey | BNBQIVXXOYLIJP-QYYOXRAYSA-N |
| XLogP | 3.66 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |