C25H33N3O3 — CID 166614780
[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(5-propyl-1,2-oxazol-3-yl)methanone (PubChem CID 166614780) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is [(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(5-propyl-1,2-oxazol-3-yl)methanone.
| Compound Name | [(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(5-propyl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 166614780 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | [(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(5-propyl-1,2-oxazol-3-yl)methanone |
| SMILES | CCCc1cc(C(=O)N2C[C@@H]3C[C@H](C2)[C@@H]2CCC[C@H](c4ccc(OC)cc4)N2C3)no1 |
| InChI | InChI=1S/C25H33N3O3/c1-3-5-21-13-22(26-31-21)25(29)27-14-17-12-19(16-27)24-7-4-6-23(28(24)15-17)18-8-10-20(30-2)11-9-18/h8-11,13,17,19,23-24H,3-7,12,14-16H2,1-2H3/t17-,19+,23+,24-/m0/s1 |
| InChIKey | FJKMKWCVKFHVBQ-QOYWPIMFSA-N |
| XLogP | 4.32 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |