C25H31N3O2 — CID 165420782
1-[2-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-4-pyridinyl]ethanone (PubChem CID 165420782) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[2-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-4-pyridinyl]ethanone.
| Compound Name | 1-[2-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-4-pyridinyl]ethanone |
|---|---|
| PubChem CID | 165420782 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 1-[2-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-4-pyridinyl]ethanone |
| SMILES | COc1ccc([C@H]2CCC[C@H]3[C@@H]4C[C@@H](CN(c5cc(C(C)=O)ccn5)C4)CN23)cc1 |
| InChI | InChI=1S/C25H31N3O2/c1-17(29)20-10-11-26-25(13-20)27-14-18-12-21(16-27)24-5-3-4-23(28(24)15-18)19-6-8-22(30-2)9-7-19/h6-11,13,18,21,23-24H,3-5,12,14-16H2,1-2H3/t18-,21+,23+,24-/m0/s1 |
| InChIKey | ULJLTJDRBSSRDC-DAQNBYSMSA-N |
| XLogP | 4.34 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |