C23H30N4O3 — CID 171707899
formic acid;(1R,2S,6R,9R)-6-(4-methoxyphenyl)-11-pyrazin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecane (PubChem CID 171707899) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is formic acid;(1R,2S,6R,9R)-6-(4-methoxyphenyl)-11-pyrazin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecane.
| Compound Name | formic acid;(1R,2S,6R,9R)-6-(4-methoxyphenyl)-11-pyrazin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecane |
|---|---|
| PubChem CID | 171707899 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | formic acid;(1R,2S,6R,9R)-6-(4-methoxyphenyl)-11-pyrazin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecane |
| SMILES | COc1ccc([C@H]2CCC[C@H]3[C@@H]4C[C@@H](CN(c5cnccn5)C4)CN23)cc1.O=CO |
| InChI | InChI=1S/C22H28N4O.CH2O2/c1-27-19-7-5-17(6-8-19)20-3-2-4-21-18-11-16(14-26(20)21)13-25(15-18)22-12-23-9-10-24-22;2-1-3/h5-10,12,16,18,20-21H,2-4,11,13-15H2,1H3;1H,(H,2,3)/t16-,18+,20+,21-;/m0./s1 |
| InChIKey | CTVFBDCUMHMIOE-CFPSDHENSA-N |
| XLogP | 3.24 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|