C23H37Cl2N3O2 — CID 171322188
(2S)-2-amino-1-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-methylbutan-1-one;dihydrochloride (PubChem CID 171322188) has the molecular formula C23H37Cl2N3O2 and a molecular weight of 458.47 g/mol. Its IUPAC name is (2S)-2-amino-1-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-methylbutan-1-one;dihydrochloride.
| Compound Name | (2S)-2-amino-1-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-methylbutan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 171322188 |
| Molecular Formula | C23H37Cl2N3O2 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | (2S)-2-amino-1-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-methylbutan-1-one;dihydrochloride |
| SMILES | COc1ccc([C@H]2CCC[C@H]3[C@@H]4C[C@@H](CN(C(=O)[C@@H](N)C(C)C)C4)CN23)cc1.Cl.Cl |
| InChI | InChI=1S/C23H35N3O2.2ClH/c1-15(2)22(24)23(27)25-12-16-11-18(14-25)21-6-4-5-20(26(21)13-16)17-7-9-19(28-3)10-8-17;;/h7-10,15-16,18,20-22H,4-6,11-14,24H2,1-3H3;2*1H/t16-,18+,20+,21-,22-;;/m0../s1 |
| InChIKey | VLKVTEIYXPRLPD-IGUIQXTLSA-N |
| XLogP | 3.90 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |