C22H32N2O2S — CID 166618652
1-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-methylsulfanylpropan-1-one (PubChem CID 166618652) has the molecular formula C22H32N2O2S and a molecular weight of 388.58 g/mol. Its IUPAC name is 1-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-methylsulfanylpropan-1-one.
| Compound Name | 1-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-methylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 166618652 |
| Molecular Formula | C22H32N2O2S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-methylsulfanylpropan-1-one |
| SMILES | COc1ccc([C@H]2CCC[C@H]3[C@@H]4C[C@@H](CN(C(=O)CCSC)C4)CN23)cc1 |
| InChI | InChI=1S/C22H32N2O2S/c1-26-19-8-6-17(7-9-19)20-4-3-5-21-18-12-16(14-24(20)21)13-23(15-18)22(25)10-11-27-2/h6-9,16,18,20-21H,3-5,10-15H2,1-2H3/t16-,18+,20+,21-/m0/s1 |
| InChIKey | SLGMIAKILINSPW-QAKNJHSXSA-N |
| XLogP | 3.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |