C21H28N4OS — CID 166619406
2-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-5-methyl-1,3,4-thiadiazole (PubChem CID 166619406) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is 2-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 166619406 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-5-methyl-1,3,4-thiadiazole |
| SMILES | COc1ccc([C@H]2CCC[C@H]3[C@@H]4C[C@@H](CN(c5nnc(C)s5)C4)CN23)cc1 |
| InChI | InChI=1S/C21H28N4OS/c1-14-22-23-21(27-14)24-11-15-10-17(13-24)20-5-3-4-19(25(20)12-15)16-6-8-18(26-2)9-7-16/h6-9,15,17,19-20H,3-5,10-13H2,1-2H3/t15-,17+,19+,20-/m0/s1 |
| InChIKey | XNCPEGJYKYSAGV-ZSXHRAQDSA-N |
| XLogP | 3.91 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |