C24H35N3O2 — CID 164692779
2-(cyclopropylamino)-1-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone (PubChem CID 164692779) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 2-(cyclopropylamino)-1-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone.
| Compound Name | 2-(cyclopropylamino)-1-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone |
|---|---|
| PubChem CID | 164692779 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 2-(cyclopropylamino)-1-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(C(=O)CNC4CC4)C3)[C@@H]3CCCCN32)c1 |
| InChI | InChI=1S/C24H35N3O2/c1-29-21-6-4-5-17(11-21)12-23-19-13-18(22-7-2-3-10-27(22)23)15-26(16-19)24(28)14-25-20-8-9-20/h4-6,11,18-20,22-23,25H,2-3,7-10,12-16H2,1H3/t18-,19+,22+,23+/m1/s1 |
| InChIKey | KKUPUDGULGXXLX-FUKQBSRTSA-N |
| XLogP | 2.69 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |