C23H30N4O — CID 163314815
(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-pyrazin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecane (PubChem CID 163314815) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-pyrazin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecane.
| Compound Name | (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-pyrazin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecane |
|---|---|
| PubChem CID | 163314815 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-pyrazin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecane |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(c4cnccn4)C3)[C@@H]3CCCCN32)c1 |
| InChI | InChI=1S/C23H30N4O/c1-28-20-6-4-5-17(11-20)12-22-19-13-18(21-7-2-3-10-27(21)22)15-26(16-19)23-14-24-8-9-25-23/h4-6,8-9,11,14,18-19,21-22H,2-3,7,10,12-13,15-16H2,1H3/t18-,19+,21+,22+/m1/s1 |
| InChIKey | YAIJEQMHNFORHM-WAGURGNTSA-N |
| XLogP | 3.41 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |