C25H31N3O3 — CID 165426585
4-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1H-pyridin-2-one (PubChem CID 165426585) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1H-pyridin-2-one.
| Compound Name | 4-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 165426585 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 4-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1H-pyridin-2-one |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(C(=O)c4cc[nH]c(=O)c4)C3)[C@@H]3CCCCN32)c1 |
| InChI | InChI=1S/C25H31N3O3/c1-31-21-6-4-5-17(11-21)12-23-20-13-19(22-7-2-3-10-28(22)23)15-27(16-20)25(30)18-8-9-26-24(29)14-18/h4-6,8-9,11,14,19-20,22-23H,2-3,7,10,12-13,15-16H2,1H3,(H,26,29)/t19-,20+,22+,23+/m1/s1 |
| InChIKey | KXPFXCIWFFKULH-VAPSRWTKSA-N |
| XLogP | 2.94 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |