C27H32N4O — CID 164693789
[(1R,2S,8S,9S)-8-benzyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(1-methylbenzimidazol-5-yl)methanone (PubChem CID 164693789) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is [(1R,2S,8S,9S)-8-benzyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(1-methylbenzimidazol-5-yl)methanone.
| Compound Name | [(1R,2S,8S,9S)-8-benzyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(1-methylbenzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 164693789 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | [(1R,2S,8S,9S)-8-benzyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(1-methylbenzimidazol-5-yl)methanone |
| SMILES | Cn1cnc2cc(C(=O)N3C[C@H]4C[C@@H](C3)[C@H](Cc3ccccc3)N3CCCC[C@@H]43)ccc21 |
| InChI | InChI=1S/C27H32N4O/c1-29-18-28-23-15-20(10-11-25(23)29)27(32)30-16-21-14-22(17-30)26(13-19-7-3-2-4-8-19)31-12-6-5-9-24(21)31/h2-4,7-8,10-11,15,18,21-22,24,26H,5-6,9,12-14,16-17H2,1H3/t21-,22+,24+,26+/m1/s1 |
| InChIKey | MGVQMKRHLZGAAJ-MXRVMPPXSA-N |
| XLogP | 4.13 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |