C25H29FN2O — CID 163310022
[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-phenylmethanone (PubChem CID 163310022) has the molecular formula C25H29FN2O and a molecular weight of 392.52 g/mol. Its IUPAC name is [(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-phenylmethanone.
| Compound Name | [(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-phenylmethanone |
|---|---|
| PubChem CID | 163310022 |
| Molecular Formula | C25H29FN2O |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | [(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1C[C@H]2C[C@@H](C1)[C@H](Cc1cccc(F)c1)N1CCCC[C@@H]21 |
| InChI | InChI=1S/C25H29FN2O/c26-22-10-6-7-18(13-22)14-24-21-15-20(23-11-4-5-12-28(23)24)16-27(17-21)25(29)19-8-2-1-3-9-19/h1-3,6-10,13,20-21,23-24H,4-5,11-12,14-17H2/t20-,21+,23+,24+/m1/s1 |
| InChIKey | XEOGXGDCCLGXPF-KJBBBAAKSA-N |
| XLogP | 4.38 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |