C25H31FN4O — CID 163317594
(2-ethylpyrimidin-5-yl)-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone (PubChem CID 163317594) has the molecular formula C25H31FN4O and a molecular weight of 422.55 g/mol. Its IUPAC name is (2-ethylpyrimidin-5-yl)-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone.
| Compound Name | (2-ethylpyrimidin-5-yl)-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone |
|---|---|
| PubChem CID | 163317594 |
| Molecular Formula | C25H31FN4O |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | (2-ethylpyrimidin-5-yl)-[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone |
| SMILES | CCc1ncc(C(=O)N2C[C@H]3C[C@@H](C2)[C@H](Cc2cccc(F)c2)N2CCCC[C@@H]32)cn1 |
| InChI | InChI=1S/C25H31FN4O/c1-2-24-27-13-20(14-28-24)25(31)29-15-18-12-19(16-29)23(30-9-4-3-8-22(18)30)11-17-6-5-7-21(26)10-17/h5-7,10,13-14,18-19,22-23H,2-4,8-9,11-12,15-16H2,1H3/t18-,19+,22+,23+/m1/s1 |
| InChIKey | SCKNLKNVKKIPLW-FUKQBSRTSA-N |
| XLogP | 3.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |