C22H29FN4S — CID 164698159
2-[[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]-5-methyl-1,3,4-thiadiazole (PubChem CID 164698159) has the molecular formula C22H29FN4S and a molecular weight of 400.57 g/mol. Its IUPAC name is 2-[[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-[[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 164698159 |
| Molecular Formula | C22H29FN4S |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-[[(1R,2S,8S,9S)-8-[(3-fluorophenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(CN2C[C@H]3C[C@@H](C2)[C@H](Cc2cccc(F)c2)N2CCCC[C@@H]32)s1 |
| InChI | InChI=1S/C22H29FN4S/c1-15-24-25-22(28-15)14-26-12-17-11-18(13-26)21(27-8-3-2-7-20(17)27)10-16-5-4-6-19(23)9-16/h4-6,9,17-18,20-21H,2-3,7-8,10-14H2,1H3/t17-,18+,20+,21+/m1/s1 |
| InChIKey | FTQXYELICDZCTO-ZFMNYDKASA-N |
| XLogP | 3.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |