C24H32N4O — CID 163318733
(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(6-methylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecane (PubChem CID 163318733) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(6-methylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecane.
| Compound Name | (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(6-methylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecane |
|---|---|
| PubChem CID | 163318733 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(6-methylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecane |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(c4ccc(C)nn4)C3)[C@@H]3CCCCN32)c1 |
| InChI | InChI=1S/C24H32N4O/c1-17-9-10-24(26-25-17)27-15-19-14-20(16-27)23(28-11-4-3-8-22(19)28)13-18-6-5-7-21(12-18)29-2/h5-7,9-10,12,19-20,22-23H,3-4,8,11,13-16H2,1-2H3/t19-,20+,22+,23+/m1/s1 |
| InChIKey | YTEDATXCZDZORI-VAPSRWTKSA-N |
| XLogP | 3.72 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |