C25H28N4O4 — CID 166599766
formic acid;(1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(6-methylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 166599766) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is formic acid;(1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(6-methylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | formic acid;(1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(6-methylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 166599766 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | formic acid;(1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-(6-methylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(c4ccc(C)nn4)C3)c3cccc(=O)n32)c1.O=CO |
| InChI | InChI=1S/C24H26N4O2.CH2O2/c1-16-9-10-23(26-25-16)27-14-18-13-19(15-27)22(28-21(18)7-4-8-24(28)29)12-17-5-3-6-20(11-17)30-2;2-1-3/h3-11,18-19,22H,12-15H2,1-2H3;1H,(H,2,3)/t18-,19+,22+;/m1./s1 |
| InChIKey | FAIRCLSVYACZJO-VODWKBETSA-N |
| XLogP | 3.06 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|