C25H32ClN3O3 — CID 171317249
(1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-[(2S)-piperidine-2-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;hydrochloride (PubChem CID 171317249) has the molecular formula C25H32ClN3O3 and a molecular weight of 458.00 g/mol. Its IUPAC name is (1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-[(2S)-piperidine-2-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;hydrochloride.
| Compound Name | (1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-[(2S)-piperidine-2-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;hydrochloride |
|---|---|
| PubChem CID | 171317249 |
| Molecular Formula | C25H32ClN3O3 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | (1R,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-[(2S)-piperidine-2-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one;hydrochloride |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(C(=O)[C@@H]4CCCCN4)C3)c3cccc(=O)n32)c1.Cl |
| InChI | InChI=1S/C25H31N3O3.ClH/c1-31-20-7-4-6-17(12-20)13-23-19-14-18(22-9-5-10-24(29)28(22)23)15-27(16-19)25(30)21-8-2-3-11-26-21;/h4-7,9-10,12,18-19,21,23,26H,2-3,8,11,13-16H2,1H3;1H/t18-,19+,21+,23+;/m1./s1 |
| InChIKey | NXVUTIWCQFTKOD-GSNBXDQKSA-N |
| XLogP | 3.15 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |